C25H23Br2Cl2N3O4 — CID 126002961
N-[(E)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[3-(dimethylamino)phenoxy]acetamide (PubChem CID 126002961) has the molecular formula C25H23Br2Cl2N3O4 and a molecular weight of 660.19 g/mol. Its IUPAC name is N-[(E)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[3-(dimethylamino)phenoxy]acetamide.
| Compound Name | N-[(E)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[3-(dimethylamino)phenoxy]acetamide |
|---|---|
| PubChem CID | 126002961 |
| Molecular Formula | C25H23Br2Cl2N3O4 |
| Molecular Weight | 660.19 g/mol |
| Exact Mass | 656.94 |
| IUPAC Name | N-[(E)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[3-(dimethylamino)phenoxy]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)COc2cccc(N(C)C)c2)c(Br)c(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H23Br2Cl2N3O4/c1-32(2)17-5-4-6-18(11-17)35-14-22(33)31-30-12-16-10-21(34-3)25(24(27)23(16)26)36-13-15-7-8-19(28)20(29)9-15/h4-12H,13-14H2,1-3H3,(H,31,33)/b30-12+ |
| InChIKey | DDBZJYDNXDMCKE-PNQUVVCRSA-N |
| XLogP | 6.70 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.19 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|