C24H17Br2Cl2F3N2O3 — CID 126002964
N-[(E)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 126002964) has the molecular formula C24H17Br2Cl2F3N2O3 and a molecular weight of 669.12 g/mol. Its IUPAC name is N-[(E)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(E)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 126002964 |
| Molecular Formula | C24H17Br2Cl2F3N2O3 |
| Molecular Weight | 669.12 g/mol |
| Exact Mass | 665.89 |
| IUPAC Name | N-[(E)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cc2cccc(C(F)(F)F)c2)c(Br)c(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H17Br2Cl2F3N2O3/c1-35-19-10-15(11-32-33-20(34)9-13-3-2-4-16(7-13)24(29,30)31)21(25)22(26)23(19)36-12-14-5-6-17(27)18(28)8-14/h2-8,10-11H,9,12H2,1H3,(H,33,34)/b32-11+ |
| InChIKey | DDQMQPYZKLHDLU-MPRHAZATSA-N |
| XLogP | 7.82 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.12 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|