C24H18BrClF3N3O4 — CID 19661207
N'-[(E)-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 19661207) has the molecular formula C24H18BrClF3N3O4 and a molecular weight of 584.78 g/mol. Its IUPAC name is N'-[(E)-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-[(E)-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 19661207 |
| Molecular Formula | C24H18BrClF3N3O4 |
| Molecular Weight | 584.78 g/mol |
| Exact Mass | 583.01 |
| IUPAC Name | N'-[(E)-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | COc1cc(/C=N/NC(=O)C(=O)Nc2cccc(C(F)(F)F)c2)cc(Br)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H18BrClF3N3O4/c1-35-20-10-15(9-19(25)21(20)36-13-14-4-2-6-17(26)8-14)12-30-32-23(34)22(33)31-18-7-3-5-16(11-18)24(27,28)29/h2-12H,13H2,1H3,(H,31,33)(H,32,34)/b30-12+ |
| InChIKey | LUMDAFYVBZAESL-PNQUVVCRSA-N |
| XLogP | 5.80 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.78 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|