C26H22BrClN4O4 — CID 3381178
N'-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-[4-(cyanomethyl)phenyl]oxamide (PubChem CID 3381178) has the molecular formula C26H22BrClN4O4 and a molecular weight of 569.84 g/mol. Its IUPAC name is N'-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-[4-(cyanomethyl)phenyl]oxamide.
| Compound Name | N'-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-[4-(cyanomethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 3381178 |
| Molecular Formula | C26H22BrClN4O4 |
| Molecular Weight | 569.84 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | N'-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-[4-(cyanomethyl)phenyl]oxamide |
| SMILES | CCOc1cc(C=NNC(=O)C(=O)Nc2ccc(CC#N)cc2)cc(Br)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H22BrClN4O4/c1-2-35-23-14-19(13-22(27)24(23)36-16-18-4-3-5-20(28)12-18)15-30-32-26(34)25(33)31-21-8-6-17(7-9-21)10-11-29/h3-9,12-15H,2,10,16H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | IZWZUSGBLRCTLD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|