C24H18BrCl3FN3O4 — CID 19661069
N'-[(E)-[3-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(3,5-dichlorophenyl)oxamide (PubChem CID 19661069) has the molecular formula C24H18BrCl3FN3O4 and a molecular weight of 617.69 g/mol. Its IUPAC name is N'-[(E)-[3-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(3,5-dichlorophenyl)oxamide.
| Compound Name | N'-[(E)-[3-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(3,5-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 19661069 |
| Molecular Formula | C24H18BrCl3FN3O4 |
| Molecular Weight | 617.69 g/mol |
| Exact Mass | 614.95 |
| IUPAC Name | N'-[(E)-[3-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(3,5-dichlorophenyl)oxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(=O)Nc2cc(Cl)cc(Cl)c2)cc(Br)c1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C24H18BrCl3FN3O4/c1-2-35-21-7-13(6-18(25)22(21)36-12-17-19(28)4-3-5-20(17)29)11-30-32-24(34)23(33)31-16-9-14(26)8-15(27)10-16/h3-11H,2,12H2,1H3,(H,31,33)(H,32,34)/b30-11+ |
| InChIKey | YROPVUBEPGPTEV-KNBZMSCYSA-N |
| XLogP | 6.61 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.69 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|