C25H22BrCl2N3O4 — CID 19659742
N'-[(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(3-chloro-4-methylphenyl)oxamide (PubChem CID 19659742) has the molecular formula C25H22BrCl2N3O4 and a molecular weight of 579.28 g/mol. Its IUPAC name is N'-[(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(3-chloro-4-methylphenyl)oxamide.
| Compound Name | N'-[(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(3-chloro-4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 19659742 |
| Molecular Formula | C25H22BrCl2N3O4 |
| Molecular Weight | 579.28 g/mol |
| Exact Mass | 577.02 |
| IUPAC Name | N'-[(E)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(3-chloro-4-methylphenyl)oxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(=O)Nc2ccc(C)c(Cl)c2)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22BrCl2N3O4/c1-3-34-22-11-17(10-20(26)23(22)35-14-16-5-7-18(27)8-6-16)13-29-31-25(33)24(32)30-19-9-4-15(2)21(28)12-19/h4-13H,3,14H2,1-2H3,(H,30,32)(H,31,33)/b29-13+ |
| InChIKey | DEJDYDUVHOENCK-VFLNYLIXSA-N |
| XLogP | 6.13 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.28 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|