C27H24BrF3N4O5 — CID 126172551
N'-[(Z)-[3-bromo-5-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide (PubChem CID 126172551) has the molecular formula C27H24BrF3N4O5 and a molecular weight of 621.41 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-5-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-bromo-5-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 126172551 |
| Molecular Formula | C27H24BrF3N4O5 |
| Molecular Weight | 621.41 g/mol |
| Exact Mass | 620.09 |
| IUPAC Name | N'-[(Z)-[3-bromo-5-methoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)Nc2c(C)cccc2C)cc(Br)c1OCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H24BrF3N4O5/c1-15-6-4-7-16(2)23(15)34-25(37)26(38)35-32-13-17-10-20(28)24(21(11-17)39-3)40-14-22(36)33-19-9-5-8-18(12-19)27(29,30)31/h4-13H,14H2,1-3H3,(H,33,36)(H,34,37)(H,35,38)/b32-13- |
| InChIKey | CMHGVORMIQYCEO-VKVKMMGJSA-N |
| XLogP | 5.20 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|