C26H22BrF3N4O4 — CID 126168287
N'-[(Z)-[5-bromo-2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide (PubChem CID 126168287) has the molecular formula C26H22BrF3N4O4 and a molecular weight of 591.38 g/mol. Its IUPAC name is N'-[(Z)-[5-bromo-2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide.
| Compound Name | N'-[(Z)-[5-bromo-2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 126168287 |
| Molecular Formula | C26H22BrF3N4O4 |
| Molecular Weight | 591.38 g/mol |
| Exact Mass | 590.08 |
| IUPAC Name | N'-[(Z)-[5-bromo-2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(=O)N/N=C\c1cc(Br)ccc1OCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H22BrF3N4O4/c1-15-5-3-6-16(2)23(15)33-24(36)25(37)34-31-13-17-11-19(27)9-10-21(17)38-14-22(35)32-20-8-4-7-18(12-20)26(28,29)30/h3-13H,14H2,1-2H3,(H,32,35)(H,33,36)(H,34,37)/b31-13- |
| InChIKey | BTIMROQCUUHXIF-AAPHRLRXSA-N |
| XLogP | 5.19 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.38 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|