C24H27BrN4O5 — CID 126271705
N'-[(Z)-[5-bromo-2-[2-(2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 126271705) has the molecular formula C24H27BrN4O5 and a molecular weight of 531.41 g/mol. Its IUPAC name is N'-[(Z)-[5-bromo-2-[2-(2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-[5-bromo-2-[2-(2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 126271705 |
| Molecular Formula | C24H27BrN4O5 |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | N'-[(Z)-[5-bromo-2-[2-(2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | Cc1cccc(C)c1NC(=O)COc1ccc(Br)cc1/C=N\NC(=O)C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C24H27BrN4O5/c1-15-5-3-6-16(2)22(15)28-21(30)14-34-20-9-8-18(25)11-17(20)12-27-29-24(32)23(31)26-13-19-7-4-10-33-19/h3,5-6,8-9,11-12,19H,4,7,10,13-14H2,1-2H3,(H,26,31)(H,28,30)(H,29,32)/b27-12-/t19-/m0/s1 |
| InChIKey | TUQDFBOSAJSLLN-GNCZMXOVSA-N |
| XLogP | 2.83 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|