C22H21BrCl2N4O5 — CID 126163243
N'-[(Z)-[5-bromo-2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide (PubChem CID 126163243) has the molecular formula C22H21BrCl2N4O5 and a molecular weight of 572.24 g/mol. Its IUPAC name is N'-[(Z)-[5-bromo-2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-[5-bromo-2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 126163243 |
| Molecular Formula | C22H21BrCl2N4O5 |
| Molecular Weight | 572.24 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | N'-[(Z)-[5-bromo-2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
| SMILES | O=C(COc1ccc(Br)cc1/C=N\NC(=O)C(=O)NC[C@H]1CCCO1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H21BrCl2N4O5/c23-14-3-4-19(34-12-20(30)28-17-8-15(24)7-16(25)9-17)13(6-14)10-27-29-22(32)21(31)26-11-18-2-1-5-33-18/h3-4,6-10,18H,1-2,5,11-12H2,(H,26,31)(H,28,30)(H,29,32)/b27-10-/t18-/m1/s1 |
| InChIKey | HKLYHYOMXDBWFD-LEKNGJHVSA-N |
| XLogP | 3.52 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|