C17H20BrN3O4 — CID 8989312
N'-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide (PubChem CID 8989312) has the molecular formula C17H20BrN3O4 and a molecular weight of 410.27 g/mol. Its IUPAC name is N'-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 8989312 |
| Molecular Formula | C17H20BrN3O4 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N'-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
| SMILES | C=CCOc1ccc(Br)cc1/C=N\NC(=O)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C17H20BrN3O4/c1-2-7-25-15-6-5-13(18)9-12(15)10-20-21-17(23)16(22)19-11-14-4-3-8-24-14/h2,5-6,9-10,14H,1,3-4,7-8,11H2,(H,19,22)(H,21,23)/b20-10-/t14-/m1/s1 |
| InChIKey | ROJRBAWUAABVTP-IPZKOZABSA-N |
| XLogP | 1.76 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|