C24H24Br2N4O4 — CID 4097295
N,N'-bis[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]butanediamide (PubChem CID 4097295) has the molecular formula C24H24Br2N4O4 and a molecular weight of 592.29 g/mol. Its IUPAC name is N,N'-bis[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]butanediamide.
| Compound Name | N,N'-bis[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 4097295 |
| Molecular Formula | C24H24Br2N4O4 |
| Molecular Weight | 592.29 g/mol |
| Exact Mass | 590.02 |
| IUPAC Name | N,N'-bis[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]butanediamide |
| SMILES | C=CCOc1ccc(Br)cc1C=NNC(=O)CCC(=O)NN=Cc1cc(Br)ccc1OCC=C |
| InChI | InChI=1S/C24H24Br2N4O4/c1-3-11-33-21-7-5-19(25)13-17(21)15-27-29-23(31)9-10-24(32)30-28-16-18-14-20(26)6-8-22(18)34-12-4-2/h3-8,13-16H,1-2,9-12H2,(H,29,31)(H,30,32) |
| InChIKey | ULNINHFJUKFIIQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|