C24H26N4O4 — CID 6003774
N,N'-bis[(Z)-(2-prop-2-enoxyphenyl)methylideneamino]butanediamide (PubChem CID 6003774) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N,N'-bis[(Z)-(2-prop-2-enoxyphenyl)methylideneamino]butanediamide.
| Compound Name | N,N'-bis[(Z)-(2-prop-2-enoxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 6003774 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N,N'-bis[(Z)-(2-prop-2-enoxyphenyl)methylideneamino]butanediamide |
| SMILES | C=CCOc1ccccc1/C=N\NC(=O)CCC(=O)N/N=C\c1ccccc1OCC=C |
| InChI | InChI=1S/C24H26N4O4/c1-3-15-31-21-11-7-5-9-19(21)17-25-27-23(29)13-14-24(30)28-26-18-20-10-6-8-12-22(20)32-16-4-2/h3-12,17-18H,1-2,13-16H2,(H,27,29)(H,28,30)/b25-17-,26-18- |
| InChIKey | MVROYCWWPAZHFK-MFYXSQMNSA-N |
| XLogP | 3.20 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|