C25H28N4O4 — CID 3634510
N,N'-bis[(2-prop-2-enoxyphenyl)methylideneamino]pentanediamide (PubChem CID 3634510) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N,N'-bis[(2-prop-2-enoxyphenyl)methylideneamino]pentanediamide.
| Compound Name | N,N'-bis[(2-prop-2-enoxyphenyl)methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 3634510 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N,N'-bis[(2-prop-2-enoxyphenyl)methylideneamino]pentanediamide |
| SMILES | C=CCOc1ccccc1C=NNC(=O)CCCC(=O)NN=Cc1ccccc1OCC=C |
| InChI | InChI=1S/C25H28N4O4/c1-3-16-32-22-12-7-5-10-20(22)18-26-28-24(30)14-9-15-25(31)29-27-19-21-11-6-8-13-23(21)33-17-4-2/h3-8,10-13,18-19H,1-2,9,14-17H2,(H,28,30)(H,29,31) |
| InChIKey | BUJLYLRUHHEJDE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|