C13H16BrN3OS — CID 4547863
1-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-3-ethylthiourea (PubChem CID 4547863) has the molecular formula C13H16BrN3OS and a molecular weight of 342.26 g/mol. Its IUPAC name is 1-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 4547863 |
| Molecular Formula | C13H16BrN3OS |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 1-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-3-ethylthiourea |
| SMILES | C=CCOc1ccc(Br)cc1C=NNC(=S)NCC |
| InChI | InChI=1S/C13H16BrN3OS/c1-3-7-18-12-6-5-11(14)8-10(12)9-16-17-13(19)15-4-2/h3,5-6,8-9H,1,4,7H2,2H3,(H2,15,17,19) |
| InChIKey | ZNQGTWIHNKPTIY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|