C15H20BrN3O2S — CID 6276989
1-[(Z)-(2-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-ethylthiourea (PubChem CID 6276989) has the molecular formula C15H20BrN3O2S and a molecular weight of 386.32 g/mol. Its IUPAC name is 1-[(Z)-(2-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-(2-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 6276989 |
| Molecular Formula | C15H20BrN3O2S |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 1-[(Z)-(2-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-ethylthiourea |
| SMILES | C=CCOc1cc(Br)c(/C=N\NC(=S)NCC)cc1OCC |
| InChI | InChI=1S/C15H20BrN3O2S/c1-4-7-21-14-9-12(16)11(8-13(14)20-6-3)10-18-19-15(22)17-5-2/h4,8-10H,1,5-7H2,2-3H3,(H2,17,19,22)/b18-10- |
| InChIKey | ZVBMFPDNQTZHIF-ZDLGFXPLSA-N |
| XLogP | 3.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|