C18H17BrFN3O2 — CID 126366009
N-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-2-(4-fluoroanilino)acetamide (PubChem CID 126366009) has the molecular formula C18H17BrFN3O2 and a molecular weight of 406.26 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-2-(4-fluoroanilino)acetamide.
| Compound Name | N-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-2-(4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 126366009 |
| Molecular Formula | C18H17BrFN3O2 |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-[(Z)-(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-2-(4-fluoroanilino)acetamide |
| SMILES | C=CCOc1ccc(Br)cc1/C=N\NC(=O)CNc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17BrFN3O2/c1-2-9-25-17-8-3-14(19)10-13(17)11-22-23-18(24)12-21-16-6-4-15(20)5-7-16/h2-8,10-11,21H,1,9,12H2,(H,23,24)/b22-11- |
| InChIKey | PSOOVTRLDAYGKP-JJFYIABZSA-N |
| XLogP | 3.72 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|