C19H19BrN6O4 — CID 3971940
N-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide (PubChem CID 3971940) has the molecular formula C19H19BrN6O4 and a molecular weight of 475.30 g/mol. Its IUPAC name is N-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide.
| Compound Name | N-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide |
|---|---|
| PubChem CID | 3971940 |
| Molecular Formula | C19H19BrN6O4 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | N-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide |
| SMILES | C=CCOc1ccc(Br)cc1C=NNC(=O)Cn1cnc2c(=O)n(C)c(=O)n(C)c21 |
| InChI | InChI=1S/C19H19BrN6O4/c1-4-7-30-14-6-5-13(20)8-12(14)9-22-23-15(27)10-26-11-21-16-17(26)24(2)19(29)25(3)18(16)28/h4-6,8-9,11H,1,7,10H2,2-3H3,(H,23,27) |
| InChIKey | DHSVWKFCVLBXSD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|