C17H19N5O5 — CID 23610222
N-(2,4-dimethoxyphenyl)-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide (PubChem CID 23610222) has the molecular formula C17H19N5O5 and a molecular weight of 373.37 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide |
|---|---|
| PubChem CID | 23610222 |
| Molecular Formula | C17H19N5O5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2cnc3c(=O)n(C)c(=O)n(C)c32)c(OC)c1 |
| InChI | InChI=1S/C17H19N5O5/c1-20-15-14(16(24)21(2)17(20)25)18-9-22(15)8-13(23)19-11-6-5-10(26-3)7-12(11)27-4/h5-7,9H,8H2,1-4H3,(H,19,23) |
| InChIKey | MFLCPPFCHIKFKG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |