C19H18N6O4 — CID 23610230
2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(8-methoxyquinolin-5-yl)acetamide (PubChem CID 23610230) has the molecular formula C19H18N6O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(8-methoxyquinolin-5-yl)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(8-methoxyquinolin-5-yl)acetamide |
|---|---|
| PubChem CID | 23610230 |
| Molecular Formula | C19H18N6O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)-N-(8-methoxyquinolin-5-yl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2cnc3c(=O)n(C)c(=O)n(C)c32)c2cccnc12 |
| InChI | InChI=1S/C19H18N6O4/c1-23-17-16(18(27)24(2)19(23)28)21-10-25(17)9-14(26)22-12-6-7-13(29-3)15-11(12)5-4-8-20-15/h4-8,10H,9H2,1-3H3,(H,22,26) |
| InChIKey | BUBQLTGVUUCTAF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |