C10H12N4O4 — CID 6472299
methyl 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetate (PubChem CID 6472299) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is methyl 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetate.
| Compound Name | methyl 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetate |
|---|---|
| PubChem CID | 6472299 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | methyl 2-(1,3-dimethyl-2,6-dioxopurin-9-yl)acetate |
| SMILES | COC(=O)Cn1cnc2c(=O)n(C)c(=O)n(C)c21 |
| InChI | InChI=1S/C10H12N4O4/c1-12-8-7(9(16)13(2)10(12)17)11-5-14(8)4-6(15)18-3/h5H,4H2,1-3H3 |
| InChIKey | CBIGMAWGOFTYPN-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |