C13H15N5O2 — CID 66576032
1,3-dimethyl-9-(2-pyrrol-1-ylethyl)purine-2,6-dione (PubChem CID 66576032) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 1,3-dimethyl-9-(2-pyrrol-1-ylethyl)purine-2,6-dione.
| Compound Name | 1,3-dimethyl-9-(2-pyrrol-1-ylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 66576032 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1,3-dimethyl-9-(2-pyrrol-1-ylethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2ncn(CCn3cccc3)c2n(C)c1=O |
| InChI | InChI=1S/C13H15N5O2/c1-15-11-10(12(19)16(2)13(15)20)14-9-18(11)8-7-17-5-3-4-6-17/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | GPLHPWFXVMZTNP-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 66.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |