C17H15N5O5 — CID 11501545
9-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 11501545) has the molecular formula C17H15N5O5 and a molecular weight of 369.34 g/mol. Its IUPAC name is 9-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 9-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 11501545 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 9-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2ncn(CCON3C(=O)c4ccccc4C3=O)c2n(C)c1=O |
| InChI | InChI=1S/C17H15N5O5/c1-19-13-12(16(25)20(2)17(19)26)18-9-21(13)7-8-27-22-14(23)10-5-3-4-6-11(10)15(22)24/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | HSZORJVIZBQTNT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 108.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|