C14H19N2O3+ — CID 155683089
3-(1,3-dioxoisoindol-2-yl)oxypropyl-trimethylazanium (PubChem CID 155683089) has the molecular formula C14H19N2O3+ and a molecular weight of 263.32 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)oxypropyl-trimethylazanium.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)oxypropyl-trimethylazanium |
|---|---|
| PubChem CID | 155683089 |
| Molecular Formula | C14H19N2O3+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)oxypropyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H19N2O3/c1-16(2,3)9-6-10-19-15-13(17)11-7-4-5-8-12(11)14(15)18/h4-5,7-8H,6,9-10H2,1-3H3/q+1 |
| InChIKey | LYEFQWBTAZEXSM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|