C12H12BrNO4 — CID 67469414
2-[2-(2-bromoethoxy)ethoxy]isoindole-1,3-dione (PubChem CID 67469414) has the molecular formula C12H12BrNO4 and a molecular weight of 314.14 g/mol. Its IUPAC name is 2-[2-(2-bromoethoxy)ethoxy]isoindole-1,3-dione.
| Compound Name | 2-[2-(2-bromoethoxy)ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67469414 |
| Molecular Formula | C12H12BrNO4 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 2-[2-(2-bromoethoxy)ethoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OCCOCCBr |
| InChI | InChI=1S/C12H12BrNO4/c13-5-6-17-7-8-18-14-11(15)9-3-1-2-4-10(9)12(14)16/h1-4H,5-8H2 |
| InChIKey | FEDANEYFYSQGGC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|