C12H13NO5 — CID 158595892
2-(1,3-dioxoisoindol-2-yl)oxyethyl acetate;molecular hydrogen (PubChem CID 158595892) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)oxyethyl acetate;molecular hydrogen.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)oxyethyl acetate;molecular hydrogen |
|---|---|
| PubChem CID | 158595892 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)oxyethyl acetate;molecular hydrogen |
| SMILES | CC(=O)OCCON1C(=O)c2ccccc2C1=O.[H][H] |
| InChI | InChI=1S/C12H11NO5.H2/c1-8(14)17-6-7-18-13-11(15)9-4-2-3-5-10(9)12(13)16;/h2-5H,6-7H2,1H3;1H |
| InChIKey | HVADGIVNZLKKKZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|