C19H26NO9P — CID 19993553
[2-(diethoxyphosphorylmethoxymethyl)-3-(1,3-dioxoisoindol-2-yl)oxypropyl] acetate (PubChem CID 19993553) has the molecular formula C19H26NO9P and a molecular weight of 443.39 g/mol. Its IUPAC name is [2-(diethoxyphosphorylmethoxymethyl)-3-(1,3-dioxoisoindol-2-yl)oxypropyl] acetate.
| Compound Name | [2-(diethoxyphosphorylmethoxymethyl)-3-(1,3-dioxoisoindol-2-yl)oxypropyl] acetate |
|---|---|
| PubChem CID | 19993553 |
| Molecular Formula | C19H26NO9P |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | [2-(diethoxyphosphorylmethoxymethyl)-3-(1,3-dioxoisoindol-2-yl)oxypropyl] acetate |
| SMILES | CCOP(=O)(COCC(COC(C)=O)CON1C(=O)c2ccccc2C1=O)OCC |
| InChI | InChI=1S/C19H26NO9P/c1-4-28-30(24,29-5-2)13-25-10-15(11-26-14(3)21)12-27-20-18(22)16-8-6-7-9-17(16)19(20)23/h6-9,15H,4-5,10-13H2,1-3H3 |
| InChIKey | RPXXDKMAGNXHFT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|