C11H9NO6 — CID 131031670
3-(1,3-dioxoisoindol-2-yl)oxy-2-hydroxypropanoic acid (PubChem CID 131031670) has the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)oxy-2-hydroxypropanoic acid.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)oxy-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 131031670 |
| Molecular Formula | C11H9NO6 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)oxy-2-hydroxypropanoic acid |
| SMILES | O=C(O)C(O)CON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H9NO6/c13-8(11(16)17)5-18-12-9(14)6-3-1-2-4-7(6)10(12)15/h1-4,8,13H,5H2,(H,16,17) |
| InChIKey | SLKVQKLKQZSKOT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|