C24H15ClN2O6 — CID 132568120
2-[2-(4-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)oxyethoxy]isoindole-1,3-dione (PubChem CID 132568120) has the molecular formula C24H15ClN2O6 and a molecular weight of 462.85 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)oxyethoxy]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)oxyethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 132568120 |
| Molecular Formula | C24H15ClN2O6 |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)oxyethoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OCC(ON1C(=O)c2ccccc2C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15ClN2O6/c25-15-11-9-14(10-12-15)20(33-27-23(30)18-7-3-4-8-19(18)24(27)31)13-32-26-21(28)16-5-1-2-6-17(16)22(26)29/h1-12,20H,13H2 |
| InChIKey | MKRKYOINXZRVMZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|