C9H7ClN2O3 — CID 89136693
2-[(chloroamino)methoxy]isoindole-1,3-dione (PubChem CID 89136693) has the molecular formula C9H7ClN2O3 and a molecular weight of 226.62 g/mol. Its IUPAC name is 2-[(chloroamino)methoxy]isoindole-1,3-dione.
| Compound Name | 2-[(chloroamino)methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 89136693 |
| Molecular Formula | C9H7ClN2O3 |
| Molecular Weight | 226.62 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 2-[(chloroamino)methoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OCNCl |
| InChI | InChI=1S/C9H7ClN2O3/c10-11-5-15-12-8(13)6-3-1-2-4-7(6)9(12)14/h1-4,11H,5H2 |
| InChIKey | METNHQAVXQPWOX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.62 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|