C11H10ClNO4 — CID 86101763
2-[2-(chloromethoxy)ethoxy]isoindole-1,3-dione (PubChem CID 86101763) has the molecular formula C11H10ClNO4 and a molecular weight of 255.66 g/mol. Its IUPAC name is 2-[2-(chloromethoxy)ethoxy]isoindole-1,3-dione.
| Compound Name | 2-[2-(chloromethoxy)ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 86101763 |
| Molecular Formula | C11H10ClNO4 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-[2-(chloromethoxy)ethoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OCCOCCl |
| InChI | InChI=1S/C11H10ClNO4/c12-7-16-5-6-17-13-10(14)8-3-1-2-4-9(8)11(13)15/h1-4H,5-7H2 |
| InChIKey | KXEYAHYPMUVWHB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|