C14H10ClNO3 — CID 22909408
2-(2-chloroethoxy)benzo[de]isoquinoline-1,3-dione (PubChem CID 22909408) has the molecular formula C14H10ClNO3 and a molecular weight of 275.69 g/mol. Its IUPAC name is 2-(2-chloroethoxy)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-chloroethoxy)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 22909408 |
| Molecular Formula | C14H10ClNO3 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-(2-chloroethoxy)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1OCCCl |
| InChI | InChI=1S/C14H10ClNO3/c15-7-8-19-16-13(17)10-5-1-3-9-4-2-6-11(12(9)10)14(16)18/h1-6H,7-8H2 |
| InChIKey | RFWXWVOQFCOUEV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|