C15H13NO5 — CID 87118101
2-(1-hydroperoxy-2-methoxyethyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 87118101) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-(1-hydroperoxy-2-methoxyethyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(1-hydroperoxy-2-methoxyethyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 87118101 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(1-hydroperoxy-2-methoxyethyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | COCC(OO)N1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C15H13NO5/c1-20-8-12(21-19)16-14(17)10-6-2-4-9-5-3-7-11(13(9)10)15(16)18/h2-7,12,19H,8H2,1H3 |
| InChIKey | JOVJMLDDWAAWQA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|