C18H19NO4Rh2 — CID 134846701
2-(1,1-dihydroxy-3,3-dimethylbutan-2-yl)benzo[de]isoquinoline-1,3-dione;bis(rhodium) (PubChem CID 134846701) has the molecular formula C18H19NO4Rh2 and a molecular weight of 519.17 g/mol. Its IUPAC name is 2-(1,1-dihydroxy-3,3-dimethylbutan-2-yl)benzo[de]isoquinoline-1,3-dione;bis(rhodium).
| Compound Name | 2-(1,1-dihydroxy-3,3-dimethylbutan-2-yl)benzo[de]isoquinoline-1,3-dione;bis(rhodium) |
|---|---|
| PubChem CID | 134846701 |
| Molecular Formula | C18H19NO4Rh2 |
| Molecular Weight | 519.17 g/mol |
| Exact Mass | 518.94 |
| IUPAC Name | 2-(1,1-dihydroxy-3,3-dimethylbutan-2-yl)benzo[de]isoquinoline-1,3-dione;bis(rhodium) |
| SMILES | CC(C)(C)C(C(O)O)N1C(=O)c2cccc3cccc(c23)C1=O.[Rh].[Rh] |
| InChI | InChI=1S/C18H19NO4.2Rh/c1-18(2,3)14(17(22)23)19-15(20)11-8-4-6-10-7-5-9-12(13(10)11)16(19)21;;/h4-9,14,17,22-23H,1-3H3;; |
| InChIKey | VTPMFWXRYGLJPU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|