C12H7GdNO3 — CID 174736073
gadolinium;2-hydroxybenzo[de]isoquinoline-1,3-dione (PubChem CID 174736073) has the molecular formula C12H7GdNO3 and a molecular weight of 370.44 g/mol. Its IUPAC name is gadolinium;2-hydroxybenzo[de]isoquinoline-1,3-dione.
| Compound Name | gadolinium;2-hydroxybenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 174736073 |
| Molecular Formula | C12H7GdNO3 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | gadolinium;2-hydroxybenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1O.[Gd] |
| InChI | InChI=1S/C12H7NO3.Gd/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13(11)16;/h1-6,16H; |
| InChIKey | XPYCRTZTYSEMBK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|