About azane;2-hydroxyisoindole-1,3-dione
azane;2-hydroxyisoindole-1,3-dione (PubChem CID 67653341) has the molecular formula C8H8N2O3
and a molecular weight of 180.16 g/mol. Its IUPAC name is azane;2-hydroxyisoindole-1,3-dione.
Molecular Properties
| Compound Name | azane;2-hydroxyisoindole-1,3-dione |
| PubChem CID | 67653341 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | azane;2-hydroxyisoindole-1,3-dione |
| SMILES | N.O=C1c2ccccc2C(=O)N1O |
| InChI | InChI=1S/C8H5NO3.H3N/c10-7-5-3-1-2-4-6(5)8(11)9(7)12;/h1-4,12H;1H3 |
| InChIKey | YHLDQHSDUQQNNU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze azane;2-hydroxyisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-hydroxyisoindole-1,3-dione?
The IUPAC name of azane;2-hydroxyisoindole-1,3-dione (CID 67653341) is azane;2-hydroxyisoindole-1,3-dione.
What is the SMILES notation for azane;2-hydroxyisoindole-1,3-dione?
The canonical SMILES for azane;2-hydroxyisoindole-1,3-dione is N.O=C1c2ccccc2C(=O)N1O.
What is the InChIKey of azane;2-hydroxyisoindole-1,3-dione?
The InChIKey is YHLDQHSDUQQNNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3.H3N/c10-7-5-3-1-2-4-6(5)8(11)9(7)12;/h1-4,12H;1H3.
What are the key properties of azane;2-hydroxyisoindole-1,3-dione?
azane;2-hydroxyisoindole-1,3-dione has a molecular weight of 180.16 g/mol, XLogP of 0.83, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-hydroxyisoindole-1,3-dione is sourced from PubChem (CID 67653341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).