About 2-deuteriooxyisoindole-1,3-dione
2-deuteriooxyisoindole-1,3-dione (PubChem CID 146169877) has the molecular formula C8H5NO3
and a molecular weight of 164.14 g/mol. Its IUPAC name is 2-deuteriooxyisoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-deuteriooxyisoindole-1,3-dione |
| PubChem CID | 146169877 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 2-deuteriooxyisoindole-1,3-dione |
| SMILES | [2H]ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C8H5NO3/c10-7-5-3-1-2-4-6(5)8(11)9(7)12/h1-4,12H/i12D |
| InChIKey | CFMZSMGAMPBRBE-UQBWLURTSA-N |
| XLogP | 0.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-deuteriooxyisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuteriooxyisoindole-1,3-dione?
The IUPAC name of 2-deuteriooxyisoindole-1,3-dione (CID 146169877) is 2-deuteriooxyisoindole-1,3-dione.
What is the SMILES notation for 2-deuteriooxyisoindole-1,3-dione?
The canonical SMILES for 2-deuteriooxyisoindole-1,3-dione is [2H]ON1C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-deuteriooxyisoindole-1,3-dione?
The InChIKey is CFMZSMGAMPBRBE-UQBWLURTSA-N. The full InChI is InChI=1S/C8H5NO3/c10-7-5-3-1-2-4-6(5)8(11)9(7)12/h1-4,12H/i12D.
What are the key properties of 2-deuteriooxyisoindole-1,3-dione?
2-deuteriooxyisoindole-1,3-dione has a molecular weight of 164.14 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuteriooxyisoindole-1,3-dione is sourced from PubChem (CID 146169877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).