About potassium;2-chloroisoindole-1,3-dione;hydride
potassium;2-chloroisoindole-1,3-dione;hydride (PubChem CID 175533491) has the molecular formula C8H5ClKNO2
and a molecular weight of 221.68 g/mol. Its IUPAC name is potassium;2-chloroisoindole-1,3-dione;hydride.
Molecular Properties
| Compound Name | potassium;2-chloroisoindole-1,3-dione;hydride |
| PubChem CID | 175533491 |
| Molecular Formula | C8H5ClKNO2 |
| Molecular Weight | 221.68 g/mol |
| Exact Mass | 220.96 |
| IUPAC Name | potassium;2-chloroisoindole-1,3-dione;hydride |
| SMILES | O=C1c2ccccc2C(=O)N1Cl.[H-].[K+] |
| InChI | InChI=1S/C8H4ClNO2.K.H/c9-10-7(11)5-3-1-2-4-6(5)8(10)12;;/h1-4H;;/q;+1;-1 |
| InChIKey | QUFIKUHBQSERQO-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.68 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze potassium;2-chloroisoindole-1,3-dione;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-chloroisoindole-1,3-dione;hydride?
The IUPAC name of potassium;2-chloroisoindole-1,3-dione;hydride (CID 175533491) is potassium;2-chloroisoindole-1,3-dione;hydride.
What is the SMILES notation for potassium;2-chloroisoindole-1,3-dione;hydride?
The canonical SMILES for potassium;2-chloroisoindole-1,3-dione;hydride is O=C1c2ccccc2C(=O)N1Cl.[H-].[K+].
What is the InChIKey of potassium;2-chloroisoindole-1,3-dione;hydride?
The InChIKey is QUFIKUHBQSERQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClNO2.K.H/c9-10-7(11)5-3-1-2-4-6(5)8(10)12;;/h1-4H;;/q;+1;-1.
What are the key properties of potassium;2-chloroisoindole-1,3-dione;hydride?
potassium;2-chloroisoindole-1,3-dione;hydride has a molecular weight of 221.68 g/mol, XLogP of -1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-chloroisoindole-1,3-dione;hydride is sourced from PubChem (CID 175533491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).