About 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione
2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione (PubChem CID 54574895) has the molecular formula C8H4Cl2FNO2S
and a molecular weight of 268.10 g/mol. Its IUPAC name is 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione |
| PubChem CID | 54574895 |
| Molecular Formula | C8H4Cl2FNO2S |
| Molecular Weight | 268.10 g/mol |
| Exact Mass | 266.93 |
| IUPAC Name | 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1S(F)(Cl)Cl |
| InChI | InChI=1S/C8H4Cl2FNO2S/c9-15(10,11)12-7(13)5-3-1-2-4-6(5)8(12)14/h1-4H |
| InChIKey | ZZWSGMFVNHEYBK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.10 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione?
The IUPAC name of 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione (CID 54574895) is 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione.
What is the SMILES notation for 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione?
The canonical SMILES for 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione is O=C1c2ccccc2C(=O)N1S(F)(Cl)Cl.
What is the InChIKey of 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione?
The InChIKey is ZZWSGMFVNHEYBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2FNO2S/c9-15(10,11)12-7(13)5-3-1-2-4-6(5)8(12)14/h1-4H.
What are the key properties of 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione?
2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione has a molecular weight of 268.10 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[dichloro(fluoro)-λ4-sulfanyl]isoindole-1,3-dione is sourced from PubChem (CID 54574895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).