C14H11NO2STb-2 — CID 58019216
methanethiol;2-methanidylbenzo[de]isoquinoline-1,3-dione;terbium (PubChem CID 58019216) has the molecular formula C14H11NO2STb-2 and a molecular weight of 416.24 g/mol. Its IUPAC name is methanethiol;2-methanidylbenzo[de]isoquinoline-1,3-dione;terbium.
| Compound Name | methanethiol;2-methanidylbenzo[de]isoquinoline-1,3-dione;terbium |
|---|---|
| PubChem CID | 58019216 |
| Molecular Formula | C14H11NO2STb-2 |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | methanethiol;2-methanidylbenzo[de]isoquinoline-1,3-dione;terbium |
| SMILES | [CH2-]N1C(=O)c2cccc3cccc(c23)C1=O.[CH2-]S.[Tb] |
| InChI | InChI=1S/C13H8NO2.CH3S.Tb/c1-14-12(15)9-6-2-4-8-5-3-7-10(11(8)9)13(14)16;1-2;/h2-7H,1H2;2H,1H2;/q2*-1; |
| InChIKey | KXGOMTWPQBQBGL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|