C24H20N2O11 — CID 21239173
2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyacetyl]oxyethoxy]ethyl 2-(1,3-dioxoisoindol-2-yl)oxyacetate (PubChem CID 21239173) has the molecular formula C24H20N2O11 and a molecular weight of 512.43 g/mol. Its IUPAC name is 2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyacetyl]oxyethoxy]ethyl 2-(1,3-dioxoisoindol-2-yl)oxyacetate.
| Compound Name | 2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyacetyl]oxyethoxy]ethyl 2-(1,3-dioxoisoindol-2-yl)oxyacetate |
|---|---|
| PubChem CID | 21239173 |
| Molecular Formula | C24H20N2O11 |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyacetyl]oxyethoxy]ethyl 2-(1,3-dioxoisoindol-2-yl)oxyacetate |
| SMILES | O=C(CON1C(=O)c2ccccc2C1=O)OCCOCCOC(=O)CON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H20N2O11/c27-19(13-36-25-21(29)15-5-1-2-6-16(15)22(25)30)34-11-9-33-10-12-35-20(28)14-37-26-23(31)17-7-3-4-8-18(17)24(26)32/h1-8H,9-14H2 |
| InChIKey | YTSSMGQDOZDMCP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 155.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|