C23H30N2O10 — CID 123483427
(2-oxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 123483427) has the molecular formula C23H30N2O10 and a molecular weight of 494.50 g/mol. Its IUPAC name is (2-oxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2-oxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 123483427 |
| Molecular Formula | C23H30N2O10 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (2-oxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | O=C(CCOCCOCCOCCOCCON1C(=O)c2ccccc2C1=O)ON1CCCC1=O |
| InChI | InChI=1S/C23H30N2O10/c26-20-6-3-8-24(20)35-21(27)7-9-30-10-11-31-12-13-32-14-15-33-16-17-34-25-22(28)18-4-1-2-5-19(18)23(25)29/h1-2,4-5H,3,6-17H2 |
| InChIKey | RPEBUICYOTUGLO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|