C12H17ClN2O6 — CID 158649274
2-aminooxyethanol;2-(2-hydroxyethoxy)isoindole-1,3-dione;hydrochloride (PubChem CID 158649274) has the molecular formula C12H17ClN2O6 and a molecular weight of 320.73 g/mol. Its IUPAC name is 2-aminooxyethanol;2-(2-hydroxyethoxy)isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-aminooxyethanol;2-(2-hydroxyethoxy)isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 158649274 |
| Molecular Formula | C12H17ClN2O6 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-aminooxyethanol;2-(2-hydroxyethoxy)isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.NOCCO.O=C1c2ccccc2C(=O)N1OCCO |
| InChI | InChI=1S/C10H9NO4.C2H7NO2.ClH/c12-5-6-15-11-9(13)7-3-1-2-4-8(7)10(11)14;3-5-2-1-4;/h1-4,12H,5-6H2;4H,1-3H2;1H |
| InChIKey | SAYMAEOSGKADAJ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|