About 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane
2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane (PubChem CID 143480902) has the molecular formula C15H23N3O3
and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane.
Molecular Properties
| Compound Name | 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane |
| PubChem CID | 143480902 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane |
| SMILES | C=C(N)CON1C(=O)c2ccccc2C1=O.CCC.CN |
| InChI | InChI=1S/C11H10N2O3.C3H8.CH5N/c1-7(12)6-16-13-10(14)8-4-2-3-5-9(8)11(13)15;1-3-2;1-2/h2-5H,1,6,12H2;3H2,1-2H3;2H2,1H3 |
| InChIKey | RUDPCEXJXXGOPH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane?
The IUPAC name of 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane (CID 143480902) is 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane.
What is the SMILES notation for 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane?
The canonical SMILES for 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane is C=C(N)CON1C(=O)c2ccccc2C1=O.CCC.CN.
What is the InChIKey of 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane?
The InChIKey is RUDPCEXJXXGOPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3.C3H8.CH5N/c1-7(12)6-16-13-10(14)8-4-2-3-5-9(8)11(13)15;1-3-2;1-2/h2-5H,1,6,12H2;3H2,1-2H3;2H2,1H3.
What are the key properties of 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane?
2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane has a molecular weight of 293.37 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoprop-2-enoxy)isoindole-1,3-dione;methanamine;propane is sourced from PubChem (CID 143480902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).