C14H11NO6 — CID 170058298
[2-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 170058298) has the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. Its IUPAC name is [2-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170058298 |
| Molecular Formula | C14H11NO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | [2-(1,3-dioxoisoindol-2-yl)oxy-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H11NO6/c1-8(2)14(19)20-7-11(16)21-15-12(17)9-5-3-4-6-10(9)13(15)18/h3-6H,1,7H2,2H3 |
| InChIKey | CQBISVJCWZXNAA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|