C15H14N2O5 — CID 101388898
(1,3-dioxoisoindol-2-yl) 3-(2-methylprop-2-enoylamino)propanoate (PubChem CID 101388898) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 3-(2-methylprop-2-enoylamino)propanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 3-(2-methylprop-2-enoylamino)propanoate |
|---|---|
| PubChem CID | 101388898 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 3-(2-methylprop-2-enoylamino)propanoate |
| SMILES | C=C(C)C(=O)NCCC(=O)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H14N2O5/c1-9(2)13(19)16-8-7-12(18)22-17-14(20)10-5-3-4-6-11(10)15(17)21/h3-6H,1,7-8H2,2H3,(H,16,19) |
| InChIKey | WESFNRAJSICWRG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|