C20H17NO5 — CID 176730322
(1,3-dioxoisoindol-2-yl) 6-oxo-6-phenylhexanoate (PubChem CID 176730322) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 6-oxo-6-phenylhexanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 6-oxo-6-phenylhexanoate |
|---|---|
| PubChem CID | 176730322 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 6-oxo-6-phenylhexanoate |
| SMILES | O=C(CCCCC(=O)c1ccccc1)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H17NO5/c22-17(14-8-2-1-3-9-14)12-6-7-13-18(23)26-21-19(24)15-10-4-5-11-16(15)20(21)25/h1-5,8-11H,6-7,12-13H2 |
| InChIKey | KRXWGXOEETVIPB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|