C50H56N2O7 — CID 100984995
2-[11-[4-[4-[11-(1,3-dioxoisoindol-2-yl)undecanoyl]phenoxy]phenyl]-11-oxoundecyl]isoindole-1,3-dione (PubChem CID 100984995) has the molecular formula C50H56N2O7 and a molecular weight of 797.01 g/mol. Its IUPAC name is 2-[11-[4-[4-[11-(1,3-dioxoisoindol-2-yl)undecanoyl]phenoxy]phenyl]-11-oxoundecyl]isoindole-1,3-dione.
| Compound Name | 2-[11-[4-[4-[11-(1,3-dioxoisoindol-2-yl)undecanoyl]phenoxy]phenyl]-11-oxoundecyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 100984995 |
| Molecular Formula | C50H56N2O7 |
| Molecular Weight | 797.01 g/mol |
| Exact Mass | 796.41 |
| IUPAC Name | 2-[11-[4-[4-[11-(1,3-dioxoisoindol-2-yl)undecanoyl]phenoxy]phenyl]-11-oxoundecyl]isoindole-1,3-dione |
| SMILES | O=C(CCCCCCCCCCN1C(=O)c2ccccc2C1=O)c1ccc(Oc2ccc(C(=O)CCCCCCCCCCN3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C50H56N2O7/c53-45(25-13-9-5-1-3-7-11-19-35-51-47(55)41-21-15-16-22-42(41)48(51)56)37-27-31-39(32-28-37)59-40-33-29-38(30-34-40)46(54)26-14-10-6-2-4-8-12-20-36-52-49(57)43-23-17-18-24-44(43)50(52)58/h15-18,21-24,27-34H,1-14,19-20,25-26,35-36H2 |
| InChIKey | SDQJFCGDZTXVEK-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.01 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|