C17H12BrNO3 — CID 59446740
2-[3-(4-bromophenyl)-3-oxopropyl]isoindole-1,3-dione (PubChem CID 59446740) has the molecular formula C17H12BrNO3 and a molecular weight of 358.19 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(4-bromophenyl)-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59446740 |
| Molecular Formula | C17H12BrNO3 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-[3-(4-bromophenyl)-3-oxopropyl]isoindole-1,3-dione |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H12BrNO3/c18-12-7-5-11(6-8-12)15(20)9-10-19-16(21)13-3-1-2-4-14(13)17(19)22/h1-8H,9-10H2 |
| InChIKey | WOPWJPBMSSQOTL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|