C12H10BrNO3 — CID 10334833
2-(4-bromo-3-oxo(414C)butyl)isoindole-1,3-dione (PubChem CID 10334833) has the molecular formula C12H10BrNO3 and a molecular weight of 298.11 g/mol. Its IUPAC name is 2-(4-bromo-3-oxo(414C)butyl)isoindole-1,3-dione.
| Compound Name | 2-(4-bromo-3-oxo(414C)butyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 10334833 |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 298.11 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 2-(4-bromo-3-oxo(414C)butyl)isoindole-1,3-dione |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)[14CH2]Br |
| InChI | InChI=1S/C12H10BrNO3/c13-7-8(15)5-6-14-11(16)9-3-1-2-4-10(9)12(14)17/h1-4H,5-7H2/i7+2 |
| InChIKey | PTPZBCHKQSHXQZ-WGGUOBTBSA-N |
| XLogP | 1.64 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.11 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|